C19H15BrClNO2 — CID 16651520
5-(4-bromophenyl)-N-[(4-chlorophenyl)methyl]-2-methylfuran-3-carboxamide (PubChem CID 16651520) has the molecular formula C19H15BrClNO2 and a molecular weight of 404.69 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-[(4-chlorophenyl)methyl]-2-methylfuran-3-carboxamide.
| Compound Name | 5-(4-bromophenyl)-N-[(4-chlorophenyl)methyl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 16651520 |
| Molecular Formula | C19H15BrClNO2 |
| Molecular Weight | 404.69 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 5-(4-bromophenyl)-N-[(4-chlorophenyl)methyl]-2-methylfuran-3-carboxamide |
| SMILES | Cc1oc(-c2ccc(Br)cc2)cc1C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H15BrClNO2/c1-12-17(10-18(24-12)14-4-6-15(20)7-5-14)19(23)22-11-13-2-8-16(21)9-3-13/h2-10H,11H2,1H3,(H,22,23) |
| InChIKey | JYSUNGBRSVWSCZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.69 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |