C20H15ClF3NO2 — CID 155515471
5-(4-chlorophenyl)-2-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]furan-3-carboxamide (PubChem CID 155515471) has the molecular formula C20H15ClF3NO2 and a molecular weight of 393.79 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]furan-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-2-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 155515471 |
| Molecular Formula | C20H15ClF3NO2 |
| Molecular Weight | 393.79 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 5-(4-chlorophenyl)-2-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]furan-3-carboxamide |
| SMILES | Cc1oc(-c2ccc(Cl)cc2)cc1C(=O)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H15ClF3NO2/c1-12-17(10-18(27-12)14-5-7-16(21)8-6-14)19(26)25-11-13-3-2-4-15(9-13)20(22,23)24/h2-10H,11H2,1H3,(H,25,26) |
| InChIKey | HPHXVSOTCRSAIU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.79 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |