C15H13BrClNO — CID 974886
5-bromo-2-chloro-N-[(4-methylphenyl)methyl]benzamide (PubChem CID 974886) has the molecular formula C15H13BrClNO and a molecular weight of 338.63 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[(4-methylphenyl)methyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[(4-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 974886 |
| Molecular Formula | C15H13BrClNO |
| Molecular Weight | 338.63 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 5-bromo-2-chloro-N-[(4-methylphenyl)methyl]benzamide |
| SMILES | Cc1ccc(CNC(=O)c2cc(Br)ccc2Cl)cc1 |
| InChI | InChI=1S/C15H13BrClNO/c1-10-2-4-11(5-3-10)9-18-15(19)13-8-12(16)6-7-14(13)17/h2-8H,9H2,1H3,(H,18,19) |
| InChIKey | UQHJEJUJBDBEEV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.63 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |