C12H9BrClNO2 — CID 47204861
5-bromo-2-chloro-N-(furan-3-ylmethyl)benzamide (PubChem CID 47204861) has the molecular formula C12H9BrClNO2 and a molecular weight of 314.57 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(furan-3-ylmethyl)benzamide.
| Compound Name | 5-bromo-2-chloro-N-(furan-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 47204861 |
| Molecular Formula | C12H9BrClNO2 |
| Molecular Weight | 314.57 g/mol |
| Exact Mass | 312.95 |
| IUPAC Name | 5-bromo-2-chloro-N-(furan-3-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccoc1)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C12H9BrClNO2/c13-9-1-2-11(14)10(5-9)12(16)15-6-8-3-4-17-7-8/h1-5,7H,6H2,(H,15,16) |
| InChIKey | BJLFYFRNEPRFPR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.57 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |