C17H12BrClN2O2 — CID 121197085
5-bromo-2-chloro-N-[[5-(furan-2-yl)-3-pyridinyl]methyl]benzamide (PubChem CID 121197085) has the molecular formula C17H12BrClN2O2 and a molecular weight of 391.65 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[[5-(furan-2-yl)-3-pyridinyl]methyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[[5-(furan-2-yl)-3-pyridinyl]methyl]benzamide |
|---|---|
| PubChem CID | 121197085 |
| Molecular Formula | C17H12BrClN2O2 |
| Molecular Weight | 391.65 g/mol |
| Exact Mass | 389.98 |
| IUPAC Name | 5-bromo-2-chloro-N-[[5-(furan-2-yl)-3-pyridinyl]methyl]benzamide |
| SMILES | O=C(NCc1cncc(-c2ccco2)c1)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C17H12BrClN2O2/c18-13-3-4-15(19)14(7-13)17(22)21-9-11-6-12(10-20-8-11)16-2-1-5-23-16/h1-8,10H,9H2,(H,21,22) |
| InChIKey | CNKLVOWIRONUMV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.65 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |