C15H11BrN2O2S — CID 119105467
4-bromo-N-[[5-(furan-2-yl)-3-pyridinyl]methyl]thiophene-2-carboxamide (PubChem CID 119105467) has the molecular formula C15H11BrN2O2S and a molecular weight of 363.24 g/mol. Its IUPAC name is 4-bromo-N-[[5-(furan-2-yl)-3-pyridinyl]methyl]thiophene-2-carboxamide.
| Compound Name | 4-bromo-N-[[5-(furan-2-yl)-3-pyridinyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 119105467 |
| Molecular Formula | C15H11BrN2O2S |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | 4-bromo-N-[[5-(furan-2-yl)-3-pyridinyl]methyl]thiophene-2-carboxamide |
| SMILES | O=C(NCc1cncc(-c2ccco2)c1)c1cc(Br)cs1 |
| InChI | InChI=1S/C15H11BrN2O2S/c16-12-5-14(21-9-12)15(19)18-7-10-4-11(8-17-6-10)13-2-1-3-20-13/h1-6,8-9H,7H2,(H,18,19) |
| InChIKey | AOXRBGXJWBAPRU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |