C18H16BrNO3 — CID 3601277
5-bromo-N-(4-ethoxyphenyl)-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 3601277) has the molecular formula C18H16BrNO3 and a molecular weight of 374.23 g/mol. Its IUPAC name is 5-bromo-N-(4-ethoxyphenyl)-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-(4-ethoxyphenyl)-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 3601277 |
| Molecular Formula | C18H16BrNO3 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 5-bromo-N-(4-ethoxyphenyl)-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2oc3ccc(Br)cc3c2C)cc1 |
| InChI | InChI=1S/C18H16BrNO3/c1-3-22-14-7-5-13(6-8-14)20-18(21)17-11(2)15-10-12(19)4-9-16(15)23-17/h4-10H,3H2,1-2H3,(H,20,21) |
| InChIKey | NXPKUEPJVPSWIF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |