C23H26N2O3 — CID 8892336
5-ethoxy-3-methyl-N-(4-piperidin-1-ylphenyl)-1-benzofuran-2-carboxamide (PubChem CID 8892336) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 5-ethoxy-3-methyl-N-(4-piperidin-1-ylphenyl)-1-benzofuran-2-carboxamide.
| Compound Name | 5-ethoxy-3-methyl-N-(4-piperidin-1-ylphenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 8892336 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 5-ethoxy-3-methyl-N-(4-piperidin-1-ylphenyl)-1-benzofuran-2-carboxamide |
| SMILES | CCOc1ccc2oc(C(=O)Nc3ccc(N4CCCCC4)cc3)c(C)c2c1 |
| InChI | InChI=1S/C23H26N2O3/c1-3-27-19-11-12-21-20(15-19)16(2)22(28-21)23(26)24-17-7-9-18(10-8-17)25-13-5-4-6-14-25/h7-12,15H,3-6,13-14H2,1-2H3,(H,24,26) |
| InChIKey | NINQVRBJVIGQDI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|