C18H16FNO3 — CID 9072285
5-ethoxy-N-(3-fluorophenyl)-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 9072285) has the molecular formula C18H16FNO3 and a molecular weight of 313.33 g/mol. Its IUPAC name is 5-ethoxy-N-(3-fluorophenyl)-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | 5-ethoxy-N-(3-fluorophenyl)-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 9072285 |
| Molecular Formula | C18H16FNO3 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 5-ethoxy-N-(3-fluorophenyl)-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | CCOc1ccc2oc(C(=O)Nc3cccc(F)c3)c(C)c2c1 |
| InChI | InChI=1S/C18H16FNO3/c1-3-22-14-7-8-16-15(10-14)11(2)17(23-16)18(21)20-13-6-4-5-12(19)9-13/h4-10H,3H2,1-2H3,(H,20,21) |
| InChIKey | ZNORSZKJOKKXOT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |