C16H23BrO2S — CID 104521706
2-[bromo-(3,4-diethylphenyl)methyl]thiane 1,1-dioxide (PubChem CID 104521706) has the molecular formula C16H23BrO2S and a molecular weight of 359.33 g/mol. Its IUPAC name is 2-[bromo-(3,4-diethylphenyl)methyl]thiane 1,1-dioxide.
| Compound Name | 2-[bromo-(3,4-diethylphenyl)methyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 104521706 |
| Molecular Formula | C16H23BrO2S |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 2-[bromo-(3,4-diethylphenyl)methyl]thiane 1,1-dioxide |
| SMILES | CCc1ccc(C(Br)C2CCCCS2(=O)=O)cc1CC |
| InChI | InChI=1S/C16H23BrO2S/c1-3-12-8-9-14(11-13(12)4-2)16(17)15-7-5-6-10-20(15,18)19/h8-9,11,15-16H,3-7,10H2,1-2H3 |
| InChIKey | RYIYWRPEBXHOJK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|