C16H21BrO3S — CID 107294474
2-[bromo-(3,3-dimethyl-2H-1-benzofuran-5-yl)methyl]thiane 1,1-dioxide (PubChem CID 107294474) has the molecular formula C16H21BrO3S and a molecular weight of 373.31 g/mol. Its IUPAC name is 2-[bromo-(3,3-dimethyl-2H-1-benzofuran-5-yl)methyl]thiane 1,1-dioxide.
| Compound Name | 2-[bromo-(3,3-dimethyl-2H-1-benzofuran-5-yl)methyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 107294474 |
| Molecular Formula | C16H21BrO3S |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 2-[bromo-(3,3-dimethyl-2H-1-benzofuran-5-yl)methyl]thiane 1,1-dioxide |
| SMILES | CC1(C)COc2ccc(C(Br)C3CCCCS3(=O)=O)cc21 |
| InChI | InChI=1S/C16H21BrO3S/c1-16(2)10-20-13-7-6-11(9-12(13)16)15(17)14-5-3-4-8-21(14,18)19/h6-7,9,14-15H,3-5,8,10H2,1-2H3 |
| InChIKey | PZKJGJLBDBKHLX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|