C19H27ClO — CID 107294337
5-(1-chloro-2-cycloheptylethyl)-3,3-dimethyl-2H-1-benzofuran (PubChem CID 107294337) has the molecular formula C19H27ClO and a molecular weight of 306.88 g/mol. Its IUPAC name is 5-(1-chloro-2-cycloheptylethyl)-3,3-dimethyl-2H-1-benzofuran.
| Compound Name | 5-(1-chloro-2-cycloheptylethyl)-3,3-dimethyl-2H-1-benzofuran |
|---|---|
| PubChem CID | 107294337 |
| Molecular Formula | C19H27ClO |
| Molecular Weight | 306.88 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 5-(1-chloro-2-cycloheptylethyl)-3,3-dimethyl-2H-1-benzofuran |
| SMILES | CC1(C)COc2ccc(C(Cl)CC3CCCCCC3)cc21 |
| InChI | InChI=1S/C19H27ClO/c1-19(2)13-21-18-10-9-15(12-16(18)19)17(20)11-14-7-5-3-4-6-8-14/h9-10,12,14,17H,3-8,11,13H2,1-2H3 |
| InChIKey | PAICPUMCGGTIPF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.88 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|