C16H23ClO — CID 107294244
5-(1-chloro-3,3-dimethylbutyl)-3,3-dimethyl-2H-1-benzofuran (PubChem CID 107294244) has the molecular formula C16H23ClO and a molecular weight of 266.81 g/mol. Its IUPAC name is 5-(1-chloro-3,3-dimethylbutyl)-3,3-dimethyl-2H-1-benzofuran.
| Compound Name | 5-(1-chloro-3,3-dimethylbutyl)-3,3-dimethyl-2H-1-benzofuran |
|---|---|
| PubChem CID | 107294244 |
| Molecular Formula | C16H23ClO |
| Molecular Weight | 266.81 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 5-(1-chloro-3,3-dimethylbutyl)-3,3-dimethyl-2H-1-benzofuran |
| SMILES | CC(C)(C)CC(Cl)c1ccc2c(c1)C(C)(C)CO2 |
| InChI | InChI=1S/C16H23ClO/c1-15(2,3)9-13(17)11-6-7-14-12(8-11)16(4,5)10-18-14/h6-8,13H,9-10H2,1-5H3 |
| InChIKey | DZPVPTQGQRXWMJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.81 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|