C13H12ClF5O — CID 107294225
5-(1-chloro-2,2,3,3,3-pentafluoropropyl)-3,3-dimethyl-2H-1-benzofuran (PubChem CID 107294225) has the molecular formula C13H12ClF5O and a molecular weight of 314.68 g/mol. Its IUPAC name is 5-(1-chloro-2,2,3,3,3-pentafluoropropyl)-3,3-dimethyl-2H-1-benzofuran.
| Compound Name | 5-(1-chloro-2,2,3,3,3-pentafluoropropyl)-3,3-dimethyl-2H-1-benzofuran |
|---|---|
| PubChem CID | 107294225 |
| Molecular Formula | C13H12ClF5O |
| Molecular Weight | 314.68 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 5-(1-chloro-2,2,3,3,3-pentafluoropropyl)-3,3-dimethyl-2H-1-benzofuran |
| SMILES | CC1(C)COc2ccc(C(Cl)C(F)(F)C(F)(F)F)cc21 |
| InChI | InChI=1S/C13H12ClF5O/c1-11(2)6-20-9-4-3-7(5-8(9)11)10(14)12(15,16)13(17,18)19/h3-5,10H,6H2,1-2H3 |
| InChIKey | MMKQNYYXLQEMSB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.68 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|