C12H10ClF5O2 — CID 61085332
7-(1-chloro-2,2,3,3,3-pentafluoropropyl)-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 61085332) has the molecular formula C12H10ClF5O2 and a molecular weight of 316.65 g/mol. Its IUPAC name is 7-(1-chloro-2,2,3,3,3-pentafluoropropyl)-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 7-(1-chloro-2,2,3,3,3-pentafluoropropyl)-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 61085332 |
| Molecular Formula | C12H10ClF5O2 |
| Molecular Weight | 316.65 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 7-(1-chloro-2,2,3,3,3-pentafluoropropyl)-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | FC(F)(F)C(F)(F)C(Cl)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C12H10ClF5O2/c13-10(11(14,15)12(16,17)18)7-2-3-8-9(6-7)20-5-1-4-19-8/h2-3,6,10H,1,4-5H2 |
| InChIKey | FYRJBUMHZLOUOW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.65 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|