C11H10F5NO2 — CID 171312431
(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2,3,3,3-pentafluoropropan-1-amine (PubChem CID 171312431) has the molecular formula C11H10F5NO2 and a molecular weight of 283.20 g/mol. Its IUPAC name is (1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2,3,3,3-pentafluoropropan-1-amine.
| Compound Name | (1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2,3,3,3-pentafluoropropan-1-amine |
|---|---|
| PubChem CID | 171312431 |
| Molecular Formula | C11H10F5NO2 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | (1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2,3,3,3-pentafluoropropan-1-amine |
| SMILES | N[C@H](c1ccc2c(c1)OCCO2)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H10F5NO2/c12-10(13,11(14,15)16)9(17)6-1-2-7-8(5-6)19-4-3-18-7/h1-2,5,9H,3-4,17H2/t9-/m1/s1 |
| InChIKey | QPWQPQMXNDMJLO-SECBINFHSA-N |
| XLogP | 2.66 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|