C9H8F3NO2 — CID 66511042
(1R)-1-(1,3-benzodioxol-5-yl)-2,2,2-trifluoroethanamine (PubChem CID 66511042) has the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. Its IUPAC name is (1R)-1-(1,3-benzodioxol-5-yl)-2,2,2-trifluoroethanamine.
| Compound Name | (1R)-1-(1,3-benzodioxol-5-yl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 66511042 |
| Molecular Formula | C9H8F3NO2 |
| Molecular Weight | 219.16 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | (1R)-1-(1,3-benzodioxol-5-yl)-2,2,2-trifluoroethanamine |
| SMILES | N[C@H](c1ccc2c(c1)OCO2)C(F)(F)F |
| InChI | InChI=1S/C9H8F3NO2/c10-9(11,12)8(13)5-1-2-6-7(3-5)15-4-14-6/h1-3,8H,4,13H2/t8-/m1/s1 |
| InChIKey | JXLZUZPJXBKHRS-MRVPVSSYSA-N |
| XLogP | 1.98 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.16 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |