C9H12N2O2 — CID 55278725
(1S)-1-(1,3-benzodioxol-5-yl)ethane-1,2-diamine (PubChem CID 55278725) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is (1S)-1-(1,3-benzodioxol-5-yl)ethane-1,2-diamine.
| Compound Name | (1S)-1-(1,3-benzodioxol-5-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 55278725 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (1S)-1-(1,3-benzodioxol-5-yl)ethane-1,2-diamine |
| SMILES | NC[C@@H](N)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H12N2O2/c10-4-7(11)6-1-2-8-9(3-6)13-5-12-8/h1-3,7H,4-5,10-11H2/t7-/m1/s1 |
| InChIKey | PXABZCSHNJTEQX-SSDOTTSWSA-N |
| XLogP | 0.37 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |