C12H18ClNO2 — CID 171236418
(1S)-1-(1,3-benzodioxol-5-yl)pentan-1-amine;hydrochloride (PubChem CID 171236418) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is (1S)-1-(1,3-benzodioxol-5-yl)pentan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(1,3-benzodioxol-5-yl)pentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171236418 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | (1S)-1-(1,3-benzodioxol-5-yl)pentan-1-amine;hydrochloride |
| SMILES | CCCC[C@H](N)c1ccc2c(c1)OCO2.Cl |
| InChI | InChI=1S/C12H17NO2.ClH/c1-2-3-4-10(13)9-5-6-11-12(7-9)15-8-14-11;/h5-7,10H,2-4,8,13H2,1H3;1H/t10-;/m0./s1 |
| InChIKey | XDRNFPCQYBERJD-PPHPATTJSA-N |
| XLogP | 3.03 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |