C9H9NO3 — CID 116939007
2-amino-2-(1,3-benzodioxol-5-yl)acetaldehyde (PubChem CID 116939007) has the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. Its IUPAC name is 2-amino-2-(1,3-benzodioxol-5-yl)acetaldehyde.
| Compound Name | 2-amino-2-(1,3-benzodioxol-5-yl)acetaldehyde |
|---|---|
| PubChem CID | 116939007 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 2-amino-2-(1,3-benzodioxol-5-yl)acetaldehyde |
| SMILES | NC(C=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H9NO3/c10-7(4-11)6-1-2-8-9(3-6)13-5-12-8/h1-4,7H,5,10H2 |
| InChIKey | PLSRNGQJJCQKPG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|