C9H7BrO3 — CID 174358581
2-(1,3-benzodioxol-5-yl)-2-bromoacetaldehyde (PubChem CID 174358581) has the molecular formula C9H7BrO3 and a molecular weight of 243.06 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-2-bromoacetaldehyde.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-2-bromoacetaldehyde |
|---|---|
| PubChem CID | 174358581 |
| Molecular Formula | C9H7BrO3 |
| Molecular Weight | 243.06 g/mol |
| Exact Mass | 241.96 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-2-bromoacetaldehyde |
| SMILES | O=CC(Br)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H7BrO3/c10-7(4-11)6-1-2-8-9(3-6)13-5-12-8/h1-4,7H,5H2 |
| InChIKey | RTANVTOHAQLBSY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.06 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|