C9H9NO4 — CID 7021269
(2S)-2-azaniumyl-2-(1,3-benzodioxol-5-yl)acetate (PubChem CID 7021269) has the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. Its IUPAC name is (2S)-2-azaniumyl-2-(1,3-benzodioxol-5-yl)acetate.
| Compound Name | (2S)-2-azaniumyl-2-(1,3-benzodioxol-5-yl)acetate |
|---|---|
| PubChem CID | 7021269 |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | (2S)-2-azaniumyl-2-(1,3-benzodioxol-5-yl)acetate |
| SMILES | [NH3+][C@H](C(=O)[O-])c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H9NO4/c10-8(9(11)12)5-1-2-6-7(3-5)14-4-13-6/h1-3,8H,4,10H2,(H,11,12)/t8-/m0/s1 |
| InChIKey | VFERSVITJKMHLM-QMMMGPOBSA-N |
| XLogP | -1.55 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |