C9H7NO6 — CID 54078447
[1,3-benzodioxol-5-yl(nitro)methyl] formate (PubChem CID 54078447) has the molecular formula C9H7NO6 and a molecular weight of 225.16 g/mol. Its IUPAC name is [1,3-benzodioxol-5-yl(nitro)methyl] formate.
| Compound Name | [1,3-benzodioxol-5-yl(nitro)methyl] formate |
|---|---|
| PubChem CID | 54078447 |
| Molecular Formula | C9H7NO6 |
| Molecular Weight | 225.16 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | [1,3-benzodioxol-5-yl(nitro)methyl] formate |
| SMILES | O=COC(c1ccc2c(c1)OCO2)[N+](=O)[O-] |
| InChI | InChI=1S/C9H7NO6/c11-4-14-9(10(12)13)6-1-2-7-8(3-6)16-5-15-7/h1-4,9H,5H2 |
| InChIKey | FOGHTKSFLXINHV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.16 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|