C13H14N6O4 — CID 155127183
5-[1-(1,3-benzodioxol-5-yl)-2-nitroethyl]pyrimidine-2,4,6-triamine (PubChem CID 155127183) has the molecular formula C13H14N6O4 and a molecular weight of 318.29 g/mol. Its IUPAC name is 5-[1-(1,3-benzodioxol-5-yl)-2-nitroethyl]pyrimidine-2,4,6-triamine.
| Compound Name | 5-[1-(1,3-benzodioxol-5-yl)-2-nitroethyl]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 155127183 |
| Molecular Formula | C13H14N6O4 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 5-[1-(1,3-benzodioxol-5-yl)-2-nitroethyl]pyrimidine-2,4,6-triamine |
| SMILES | Nc1nc(N)c(C(C[N+](=O)[O-])c2ccc3c(c2)OCO3)c(N)n1 |
| InChI | InChI=1S/C13H14N6O4/c14-11-10(12(15)18-13(16)17-11)7(4-19(20)21)6-1-2-8-9(3-6)23-5-22-8/h1-3,7H,4-5H2,(H6,14,15,16,17,18) |
| InChIKey | SJCFAWLLSBCCQN-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 165.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|