C18H21NO7 — CID 174341809
2-[1-(1,3-benzodioxol-5-yl)-2-nitroethyl]-2-methyl-3-oxooct-6-enoic acid (PubChem CID 174341809) has the molecular formula C18H21NO7 and a molecular weight of 363.37 g/mol. Its IUPAC name is 2-[1-(1,3-benzodioxol-5-yl)-2-nitroethyl]-2-methyl-3-oxooct-6-enoic acid.
| Compound Name | 2-[1-(1,3-benzodioxol-5-yl)-2-nitroethyl]-2-methyl-3-oxooct-6-enoic acid |
|---|---|
| PubChem CID | 174341809 |
| Molecular Formula | C18H21NO7 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-[1-(1,3-benzodioxol-5-yl)-2-nitroethyl]-2-methyl-3-oxooct-6-enoic acid |
| SMILES | CC=CCCC(=O)C(C)(C(=O)O)C(C[N+](=O)[O-])c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H21NO7/c1-3-4-5-6-16(20)18(2,17(21)22)13(10-19(23)24)12-7-8-14-15(9-12)26-11-25-14/h3-4,7-9,13H,5-6,10-11H2,1-2H3,(H,21,22) |
| InChIKey | BBECSRCGJAQPAF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|