C13H15NO5 — CID 25178403
(2S)-1-(1,3-benzodioxol-5-yl)-3-methyl-2-(nitromethyl)butan-1-one (PubChem CID 25178403) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is (2S)-1-(1,3-benzodioxol-5-yl)-3-methyl-2-(nitromethyl)butan-1-one.
| Compound Name | (2S)-1-(1,3-benzodioxol-5-yl)-3-methyl-2-(nitromethyl)butan-1-one |
|---|---|
| PubChem CID | 25178403 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (2S)-1-(1,3-benzodioxol-5-yl)-3-methyl-2-(nitromethyl)butan-1-one |
| SMILES | CC(C)[C@@H](C[N+](=O)[O-])C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H15NO5/c1-8(2)10(6-14(16)17)13(15)9-3-4-11-12(5-9)19-7-18-11/h3-5,8,10H,6-7H2,1-2H3/t10-/m1/s1 |
| InChIKey | ZYVAZSWERUFNGL-SNVBAGLBSA-N |
| XLogP | 2.15 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|