C12H12F3NO3 — CID 167488987
1-(1,3-benzodioxol-5-yl)-2-(1,1,2-trifluoroethylamino)propan-1-one (PubChem CID 167488987) has the molecular formula C12H12F3NO3 and a molecular weight of 275.23 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(1,1,2-trifluoroethylamino)propan-1-one.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(1,1,2-trifluoroethylamino)propan-1-one |
|---|---|
| PubChem CID | 167488987 |
| Molecular Formula | C12H12F3NO3 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(1,1,2-trifluoroethylamino)propan-1-one |
| SMILES | CC(NC(F)(F)CF)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H12F3NO3/c1-7(16-12(14,15)5-13)11(17)8-2-3-9-10(4-8)19-6-18-9/h2-4,7,16H,5-6H2,1H3 |
| InChIKey | SOBIOBLJOXRIKG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|