C10H9NO7 — CID 162639433
[1,3-benzodioxol-5-yl(nitro)methyl] methyl carbonate (PubChem CID 162639433) has the molecular formula C10H9NO7 and a molecular weight of 255.18 g/mol. Its IUPAC name is [1,3-benzodioxol-5-yl(nitro)methyl] methyl carbonate.
| Compound Name | [1,3-benzodioxol-5-yl(nitro)methyl] methyl carbonate |
|---|---|
| PubChem CID | 162639433 |
| Molecular Formula | C10H9NO7 |
| Molecular Weight | 255.18 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | [1,3-benzodioxol-5-yl(nitro)methyl] methyl carbonate |
| SMILES | COC(=O)OC(c1ccc2c(c1)OCO2)[N+](=O)[O-] |
| InChI | InChI=1S/C10H9NO7/c1-15-10(12)18-9(11(13)14)6-2-3-7-8(4-6)17-5-16-7/h2-4,9H,5H2,1H3 |
| InChIKey | OGXANPDGSYOKPX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.18 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|