C21H29NO7 — CID 10501556
ethyl 2-[1-(1,3-benzodioxol-5-yl)-2-nitroethyl]-4,4-dimethyl-3-oxooctanoate (PubChem CID 10501556) has the molecular formula C21H29NO7 and a molecular weight of 407.46 g/mol. Its IUPAC name is ethyl 2-[1-(1,3-benzodioxol-5-yl)-2-nitroethyl]-4,4-dimethyl-3-oxooctanoate.
| Compound Name | ethyl 2-[1-(1,3-benzodioxol-5-yl)-2-nitroethyl]-4,4-dimethyl-3-oxooctanoate |
|---|---|
| PubChem CID | 10501556 |
| Molecular Formula | C21H29NO7 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | ethyl 2-[1-(1,3-benzodioxol-5-yl)-2-nitroethyl]-4,4-dimethyl-3-oxooctanoate |
| SMILES | CCCCC(C)(C)C(=O)C(C(=O)OCC)C(C[N+](=O)[O-])c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H29NO7/c1-5-7-10-21(3,4)19(23)18(20(24)27-6-2)15(12-22(25)26)14-8-9-16-17(11-14)29-13-28-16/h8-9,11,15,18H,5-7,10,12-13H2,1-4H3 |
| InChIKey | WSGWIOZCXJZIIS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|