C23H26O5 — CID 19363908
ethyl 2-(1,3-benzodioxol-5-yl)-3-(4-tert-butylphenyl)-4-oxobutanoate (PubChem CID 19363908) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is ethyl 2-(1,3-benzodioxol-5-yl)-3-(4-tert-butylphenyl)-4-oxobutanoate.
| Compound Name | ethyl 2-(1,3-benzodioxol-5-yl)-3-(4-tert-butylphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 19363908 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | ethyl 2-(1,3-benzodioxol-5-yl)-3-(4-tert-butylphenyl)-4-oxobutanoate |
| SMILES | CCOC(=O)C(c1ccc2c(c1)OCO2)C(C=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H26O5/c1-5-26-22(25)21(16-8-11-19-20(12-16)28-14-27-19)18(13-24)15-6-9-17(10-7-15)23(2,3)4/h6-13,18,21H,5,14H2,1-4H3 |
| InChIKey | JFNJFCLERRPSNL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|