C21H22O6 — CID 19363981
ethyl 2-(1,3-benzodioxol-5-yl)-3-(4-methoxy-3-methylphenyl)-4-oxobutanoate (PubChem CID 19363981) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is ethyl 2-(1,3-benzodioxol-5-yl)-3-(4-methoxy-3-methylphenyl)-4-oxobutanoate.
| Compound Name | ethyl 2-(1,3-benzodioxol-5-yl)-3-(4-methoxy-3-methylphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 19363981 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | ethyl 2-(1,3-benzodioxol-5-yl)-3-(4-methoxy-3-methylphenyl)-4-oxobutanoate |
| SMILES | CCOC(=O)C(c1ccc2c(c1)OCO2)C(C=O)c1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C21H22O6/c1-4-25-21(23)20(15-6-8-18-19(10-15)27-12-26-18)16(11-22)14-5-7-17(24-3)13(2)9-14/h5-11,16,20H,4,12H2,1-3H3 |
| InChIKey | YSDFKHHYTFTMMO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|