C14H18O4 — CID 167140833
ethyl (2R,3R)-3-(1,3-benzodioxol-5-yl)-2-methylbutanoate (PubChem CID 167140833) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is ethyl (2R,3R)-3-(1,3-benzodioxol-5-yl)-2-methylbutanoate.
| Compound Name | ethyl (2R,3R)-3-(1,3-benzodioxol-5-yl)-2-methylbutanoate |
|---|---|
| PubChem CID | 167140833 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | ethyl (2R,3R)-3-(1,3-benzodioxol-5-yl)-2-methylbutanoate |
| SMILES | CCOC(=O)[C@H](C)[C@@H](C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H18O4/c1-4-16-14(15)10(3)9(2)11-5-6-12-13(7-11)18-8-17-12/h5-7,9-10H,4,8H2,1-3H3/t9-,10-/m1/s1 |
| InChIKey | CAIXTAWSHAKSPJ-NXEZZACHSA-N |
| XLogP | 2.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |