methyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate

C13H16O5 — CID 66288795

IUPACmethyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate
SMILESCOC(=O)C(O)C(C)c1ccc2c(c1)OCCO2
InChIInChI=1S/C13H16O5/c1-8(12(14)13(15)16-2)9-3-4-10-11(7-9)18-6-5-17-10/h3-4,7-8,12,14H,5-6H2,1-2H3
InChIKeyFUGMFCJYINNGDR-UHFFFAOYSA-N
MW252.27 g/mol
LogP1.10
Rot. Bonds3

About methyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate

methyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate (PubChem CID 66288795) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is methyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate.

Molecular Properties

Compound Namemethyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate
PubChem CID66288795
Molecular FormulaC13H16O5
Molecular Weight252.27 g/mol
Exact Mass252.10
IUPAC Namemethyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate
SMILESCOC(=O)C(O)C(C)c1ccc2c(c1)OCCO2
InChIInChI=1S/C13H16O5/c1-8(12(14)13(15)16-2)9-3-4-10-11(7-9)18-6-5-17-10/h3-4,7-8,12,14H,5-6H2,1-2H3
InChIKeyFUGMFCJYINNGDR-UHFFFAOYSA-N
XLogP1.10
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.27
LogP ≤ 51.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate?
The IUPAC name of methyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate (CID 66288795) is methyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate.
What is the SMILES notation for methyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate?
The canonical SMILES for methyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate is COC(=O)C(O)C(C)c1ccc2c(c1)OCCO2.
What is the InChIKey of methyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate?
The InChIKey is FUGMFCJYINNGDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O5/c1-8(12(14)13(15)16-2)9-3-4-10-11(7-9)18-6-5-17-10/h3-4,7-8,12,14H,5-6H2,1-2H3.
What are the key properties of methyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate?
methyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate has a molecular weight of 252.27 g/mol, XLogP of 1.10, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate is sourced from PubChem (CID 66288795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).