About ethyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate
ethyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate (PubChem CID 66290653) has the molecular formula C14H18O5
and a molecular weight of 266.29 g/mol. Its IUPAC name is ethyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate.
Analyze ethyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate?
The IUPAC name of ethyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate (CID 66290653) is ethyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate.
What is the SMILES notation for ethyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate?
The canonical SMILES for ethyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate is CCOC(=O)C(O)C(C)c1ccc2c(c1)OCCO2.
What is the InChIKey of ethyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate?
The InChIKey is XKHDRAGUKXNZLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O5/c1-3-17-14(16)13(15)9(2)10-4-5-11-12(8-10)19-7-6-18-11/h4-5,8-9,13,15H,3,6-7H2,1-2H3.
What are the key properties of ethyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate?
ethyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate has a molecular weight of 266.29 g/mol, XLogP of 1.49, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-hydroxybutanoate is sourced from PubChem (CID 66290653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).