C13H13ClN2O8 — CID 21205578
ethyl 3-(7-chloro-1,3-benzodioxol-5-yl)-2,4-dinitrobutanoate (PubChem CID 21205578) has the molecular formula C13H13ClN2O8 and a molecular weight of 360.71 g/mol. Its IUPAC name is ethyl 3-(7-chloro-1,3-benzodioxol-5-yl)-2,4-dinitrobutanoate.
| Compound Name | ethyl 3-(7-chloro-1,3-benzodioxol-5-yl)-2,4-dinitrobutanoate |
|---|---|
| PubChem CID | 21205578 |
| Molecular Formula | C13H13ClN2O8 |
| Molecular Weight | 360.71 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | ethyl 3-(7-chloro-1,3-benzodioxol-5-yl)-2,4-dinitrobutanoate |
| SMILES | CCOC(=O)C(C(C[N+](=O)[O-])c1cc(Cl)c2c(c1)OCO2)[N+](=O)[O-] |
| InChI | InChI=1S/C13H13ClN2O8/c1-2-22-13(17)11(16(20)21)8(5-15(18)19)7-3-9(14)12-10(4-7)23-6-24-12/h3-4,8,11H,2,5-6H2,1H3 |
| InChIKey | XNMINNHREIXURV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 131.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.71 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|