C19H19NO5 — CID 102309778
ethyl (2S,3R)-2-benzoyl-4-nitro-3-phenylbutanoate (PubChem CID 102309778) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is ethyl (2S,3R)-2-benzoyl-4-nitro-3-phenylbutanoate.
| Compound Name | ethyl (2S,3R)-2-benzoyl-4-nitro-3-phenylbutanoate |
|---|---|
| PubChem CID | 102309778 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | ethyl (2S,3R)-2-benzoyl-4-nitro-3-phenylbutanoate |
| SMILES | CCOC(=O)[C@H](C(=O)c1ccccc1)[C@@H](C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C19H19NO5/c1-2-25-19(22)17(18(21)15-11-7-4-8-12-15)16(13-20(23)24)14-9-5-3-6-10-14/h3-12,16-17H,2,13H2,1H3/t16-,17-/m0/s1 |
| InChIKey | HEHYLYJDYOEQSS-IRXDYDNUSA-N |
| XLogP | 3.11 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|