C24H21NO5 — CID 66625024
2-[1-(2-methoxyphenyl)-2-nitroethyl]-1,3-diphenylpropane-1,3-dione (PubChem CID 66625024) has the molecular formula C24H21NO5 and a molecular weight of 403.43 g/mol. Its IUPAC name is 2-[1-(2-methoxyphenyl)-2-nitroethyl]-1,3-diphenylpropane-1,3-dione.
| Compound Name | 2-[1-(2-methoxyphenyl)-2-nitroethyl]-1,3-diphenylpropane-1,3-dione |
|---|---|
| PubChem CID | 66625024 |
| Molecular Formula | C24H21NO5 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 2-[1-(2-methoxyphenyl)-2-nitroethyl]-1,3-diphenylpropane-1,3-dione |
| SMILES | COc1ccccc1C(C[N+](=O)[O-])C(C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H21NO5/c1-30-21-15-9-8-14-19(21)20(16-25(28)29)22(23(26)17-10-4-2-5-11-17)24(27)18-12-6-3-7-13-18/h2-15,20,22H,16H2,1H3 |
| InChIKey | DVQBBFMZNJURAW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|