C20H21NO5 — CID 76575291
3-[2-nitro-1-(2-phenylmethoxyphenyl)ethyl]pentane-2,4-dione (PubChem CID 76575291) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is 3-[2-nitro-1-(2-phenylmethoxyphenyl)ethyl]pentane-2,4-dione.
| Compound Name | 3-[2-nitro-1-(2-phenylmethoxyphenyl)ethyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 76575291 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 3-[2-nitro-1-(2-phenylmethoxyphenyl)ethyl]pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)C(C[N+](=O)[O-])c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C20H21NO5/c1-14(22)20(15(2)23)18(12-21(24)25)17-10-6-7-11-19(17)26-13-16-8-4-3-5-9-16/h3-11,18,20H,12-13H2,1-2H3 |
| InChIKey | TUGZNWDUIWQAMR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|