C17H22N2O — CID 57280204
2-(2-phenylmethoxyphenyl)butane-1,3-diamine (PubChem CID 57280204) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 2-(2-phenylmethoxyphenyl)butane-1,3-diamine.
| Compound Name | 2-(2-phenylmethoxyphenyl)butane-1,3-diamine |
|---|---|
| PubChem CID | 57280204 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 2-(2-phenylmethoxyphenyl)butane-1,3-diamine |
| SMILES | CC(N)C(CN)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C17H22N2O/c1-13(19)16(11-18)15-9-5-6-10-17(15)20-12-14-7-3-2-4-8-14/h2-10,13,16H,11-12,18-19H2,1H3 |
| InChIKey | UPGSRXYPYAIRGK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |