C19H25NO2 — CID 171265324
(1R,2S)-1-amino-3-methyl-1-(2-phenylmethoxyphenyl)pentan-2-ol (PubChem CID 171265324) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is (1R,2S)-1-amino-3-methyl-1-(2-phenylmethoxyphenyl)pentan-2-ol.
| Compound Name | (1R,2S)-1-amino-3-methyl-1-(2-phenylmethoxyphenyl)pentan-2-ol |
|---|---|
| PubChem CID | 171265324 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (1R,2S)-1-amino-3-methyl-1-(2-phenylmethoxyphenyl)pentan-2-ol |
| SMILES | CCC(C)[C@H](O)[C@H](N)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C19H25NO2/c1-3-14(2)19(21)18(20)16-11-7-8-12-17(16)22-13-15-9-5-4-6-10-15/h4-12,14,18-19,21H,3,13,20H2,1-2H3/t14?,18-,19+/m1/s1 |
| InChIKey | UKGIXQMCHRAMGF-BRQZFJGMSA-N |
| XLogP | 3.67 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |