C14H20ClF4NO2 — CID 171269296
(1S,2R)-1-amino-3-methyl-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pentan-2-ol;hydrochloride (PubChem CID 171269296) has the molecular formula C14H20ClF4NO2 and a molecular weight of 345.76 g/mol. Its IUPAC name is (1S,2R)-1-amino-3-methyl-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pentan-2-ol;hydrochloride.
| Compound Name | (1S,2R)-1-amino-3-methyl-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pentan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171269296 |
| Molecular Formula | C14H20ClF4NO2 |
| Molecular Weight | 345.76 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | (1S,2R)-1-amino-3-methyl-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pentan-2-ol;hydrochloride |
| SMILES | CCC(C)[C@@H](O)[C@@H](N)c1ccccc1OC(F)(F)C(F)F.Cl |
| InChI | InChI=1S/C14H19F4NO2.ClH/c1-3-8(2)12(20)11(19)9-6-4-5-7-10(9)21-14(17,18)13(15)16;/h4-8,11-13,20H,3,19H2,1-2H3;1H/t8?,11-,12+;/m0./s1 |
| InChIKey | QPWDOOSUDKDEOC-WEVPUVDSSA-N |
| XLogP | 3.75 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.76 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|