C11H14ClF4NO — CID 171208529
(1R)-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-amine;hydrochloride (PubChem CID 171208529) has the molecular formula C11H14ClF4NO and a molecular weight of 287.68 g/mol. Its IUPAC name is (1R)-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-amine;hydrochloride.
| Compound Name | (1R)-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171208529 |
| Molecular Formula | C11H14ClF4NO |
| Molecular Weight | 287.68 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | (1R)-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-amine;hydrochloride |
| SMILES | CC[C@@H](N)c1ccccc1OC(F)(F)C(F)F.Cl |
| InChI | InChI=1S/C11H13F4NO.ClH/c1-2-8(16)7-5-3-4-6-9(7)17-11(14,15)10(12)13;/h3-6,8,10H,2,16H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | TVCNTCZYRKGFNE-DDWIOCJRSA-N |
| XLogP | 3.75 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.68 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|