C35H31Br4F8NO2 — CID 91244981
3-(2,6-dibromophenyl)-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-amine;1,3-dibromo-2-[3-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]butyl]benzene (PubChem CID 91244981) has the molecular formula C35H31Br4F8NO2 and a molecular weight of 969.24 g/mol. Its IUPAC name is 3-(2,6-dibromophenyl)-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-amine;1,3-dibromo-2-[3-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]butyl]benzene.
| Compound Name | 3-(2,6-dibromophenyl)-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-amine;1,3-dibromo-2-[3-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]butyl]benzene |
|---|---|
| PubChem CID | 91244981 |
| Molecular Formula | C35H31Br4F8NO2 |
| Molecular Weight | 969.24 g/mol |
| Exact Mass | 964.90 |
| IUPAC Name | 3-(2,6-dibromophenyl)-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-amine;1,3-dibromo-2-[3-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]butyl]benzene |
| SMILES | CC(CCc1c(Br)cccc1Br)c1ccccc1OC(F)(F)C(F)F.NC(CCc1c(Br)cccc1Br)c1ccccc1OC(F)(F)C(F)F |
| InChI | InChI=1S/C18H16Br2F4O.C17H15Br2F4NO/c1-11(9-10-13-14(19)6-4-7-15(13)20)12-5-2-3-8-16(12)25-18(23,24)17(21)22;18-12-5-3-6-13(19)10(12)8-9-14(24)11-4-1-2-7-15(11)25-17(22,23)16(20)21/h2-8,11,17H,9-10H2,1H3;1-7,14,16H,8-9,24H2 |
| InChIKey | OVFCDKGXUTZAPA-UHFFFAOYSA-N |
| XLogP | 13.27 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.24 |
| LogP ≤ 5 | 13.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|