C18H16Br2F4O — CID 59009787
1,3-dibromo-2-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butyl]benzene (PubChem CID 59009787) has the molecular formula C18H16Br2F4O and a molecular weight of 484.13 g/mol. Its IUPAC name is 1,3-dibromo-2-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butyl]benzene.
| Compound Name | 1,3-dibromo-2-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butyl]benzene |
|---|---|
| PubChem CID | 59009787 |
| Molecular Formula | C18H16Br2F4O |
| Molecular Weight | 484.13 g/mol |
| Exact Mass | 481.95 |
| IUPAC Name | 1,3-dibromo-2-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butyl]benzene |
| SMILES | CC(CCc1c(Br)cccc1Br)c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C18H16Br2F4O/c1-11(8-9-14-15(19)6-3-7-16(14)20)12-4-2-5-13(10-12)25-18(23,24)17(21)22/h2-7,10-11,17H,8-9H2,1H3 |
| InChIKey | SZCNPOFMSKAPGQ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.13 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|