C13H17F4NO3S — CID 161129597
N-[1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]propane-1-sulfonamide (PubChem CID 161129597) has the molecular formula C13H17F4NO3S and a molecular weight of 343.34 g/mol. Its IUPAC name is N-[1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]propane-1-sulfonamide.
| Compound Name | N-[1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 161129597 |
| Molecular Formula | C13H17F4NO3S |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | N-[1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NC(C)c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C13H17F4NO3S/c1-3-7-22(19,20)18-9(2)10-5-4-6-11(8-10)21-13(16,17)12(14)15/h4-6,8-9,12,18H,3,7H2,1-2H3 |
| InChIKey | ULZVZAQKEKJFPB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|