C13H16F5NO4S — CID 146353420
3-[[(1R)-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]sulfamoyl]propyl hypofluorite (PubChem CID 146353420) has the molecular formula C13H16F5NO4S and a molecular weight of 377.33 g/mol. Its IUPAC name is 3-[[(1R)-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]sulfamoyl]propyl hypofluorite.
| Compound Name | 3-[[(1R)-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]sulfamoyl]propyl hypofluorite |
|---|---|
| PubChem CID | 146353420 |
| Molecular Formula | C13H16F5NO4S |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 3-[[(1R)-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]sulfamoyl]propyl hypofluorite |
| SMILES | C[C@@H](NS(=O)(=O)CCCOF)c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C13H16F5NO4S/c1-9(19-24(20,21)7-3-6-22-18)10-4-2-5-11(8-10)23-13(16,17)12(14)15/h2,4-5,8-9,12,19H,3,6-7H2,1H3/t9-/m1/s1 |
| InChIKey | WEOVEQGPDOYBIR-SECBINFHSA-N |
| XLogP | 3.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|