C20H35NO5S — CID 146352787
3-(2,2-dimethylpropoxy)-N-[(1R)-1-[3-(2-hydroxy-2-methylpropoxy)phenyl]ethyl]propane-1-sulfonamide (PubChem CID 146352787) has the molecular formula C20H35NO5S and a molecular weight of 401.57 g/mol. Its IUPAC name is 3-(2,2-dimethylpropoxy)-N-[(1R)-1-[3-(2-hydroxy-2-methylpropoxy)phenyl]ethyl]propane-1-sulfonamide.
| Compound Name | 3-(2,2-dimethylpropoxy)-N-[(1R)-1-[3-(2-hydroxy-2-methylpropoxy)phenyl]ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 146352787 |
| Molecular Formula | C20H35NO5S |
| Molecular Weight | 401.57 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 3-(2,2-dimethylpropoxy)-N-[(1R)-1-[3-(2-hydroxy-2-methylpropoxy)phenyl]ethyl]propane-1-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)CCCOCC(C)(C)C)c1cccc(OCC(C)(C)O)c1 |
| InChI | InChI=1S/C20H35NO5S/c1-16(17-9-7-10-18(13-17)26-15-20(5,6)22)21-27(23,24)12-8-11-25-14-19(2,3)4/h7,9-10,13,16,21-22H,8,11-12,14-15H2,1-6H3/t16-/m1/s1 |
| InChIKey | FYSRSRKWSZUKSZ-MRXNPFEDSA-N |
| XLogP | 3.27 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|