C22H36O4S — CID 158308850
1-(2-cyclopropylethoxy)-3-[(2R)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]propan-2-yl]benzene (PubChem CID 158308850) has the molecular formula C22H36O4S and a molecular weight of 396.59 g/mol. Its IUPAC name is 1-(2-cyclopropylethoxy)-3-[(2R)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]propan-2-yl]benzene.
| Compound Name | 1-(2-cyclopropylethoxy)-3-[(2R)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]propan-2-yl]benzene |
|---|---|
| PubChem CID | 158308850 |
| Molecular Formula | C22H36O4S |
| Molecular Weight | 396.59 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 1-(2-cyclopropylethoxy)-3-[(2R)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]propan-2-yl]benzene |
| SMILES | C[C@@H](CS(=O)(=O)CCCOCC(C)(C)C)c1cccc(OCCC2CC2)c1 |
| InChI | InChI=1S/C22H36O4S/c1-18(16-27(23,24)14-6-12-25-17-22(2,3)4)20-7-5-8-21(15-20)26-13-11-19-9-10-19/h5,7-8,15,18-19H,6,9-14,16-17H2,1-4H3/t18-/m0/s1 |
| InChIKey | JGKQOIZIAFKMMW-SFHVURJKSA-N |
| XLogP | 4.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|