C21H34O5S — CID 158639413
3-[3-[(2R)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]propan-2-yl]phenoxy]oxolane (PubChem CID 158639413) has the molecular formula C21H34O5S and a molecular weight of 398.57 g/mol. Its IUPAC name is 3-[3-[(2R)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]propan-2-yl]phenoxy]oxolane.
| Compound Name | 3-[3-[(2R)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]propan-2-yl]phenoxy]oxolane |
|---|---|
| PubChem CID | 158639413 |
| Molecular Formula | C21H34O5S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 3-[3-[(2R)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]propan-2-yl]phenoxy]oxolane |
| SMILES | C[C@@H](CS(=O)(=O)CCCOCC(C)(C)C)c1cccc(OC2CCOC2)c1 |
| InChI | InChI=1S/C21H34O5S/c1-17(15-27(22,23)12-6-10-25-16-21(2,3)4)18-7-5-8-19(13-18)26-20-9-11-24-14-20/h5,7-8,13,17,20H,6,9-12,14-16H2,1-4H3/t17-,20?/m0/s1 |
| InChIKey | CQGISBKFAAXBDW-DIMJTDRSSA-N |
| XLogP | 3.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|