C21H36O4S — CID 158308849
1-[(2S)-butan-2-yl]oxy-3-[(2R)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]propan-2-yl]benzene (PubChem CID 158308849) has the molecular formula C21H36O4S and a molecular weight of 384.58 g/mol. Its IUPAC name is 1-[(2S)-butan-2-yl]oxy-3-[(2R)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]propan-2-yl]benzene.
| Compound Name | 1-[(2S)-butan-2-yl]oxy-3-[(2R)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]propan-2-yl]benzene |
|---|---|
| PubChem CID | 158308849 |
| Molecular Formula | C21H36O4S |
| Molecular Weight | 384.58 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 1-[(2S)-butan-2-yl]oxy-3-[(2R)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]propan-2-yl]benzene |
| SMILES | CC[C@H](C)Oc1cccc([C@@H](C)CS(=O)(=O)CCCOCC(C)(C)C)c1 |
| InChI | InChI=1S/C21H36O4S/c1-7-18(3)25-20-11-8-10-19(14-20)17(2)15-26(22,23)13-9-12-24-16-21(4,5)6/h8,10-11,14,17-18H,7,9,12-13,15-16H2,1-6H3/t17-,18-/m0/s1 |
| InChIKey | TZOXEVHWUGFYCZ-ROUUACIJSA-N |
| XLogP | 4.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|